C9H16N4O4S — CID 114464571
methyl N-[(5-tert-butyl-1H-pyrazol-3-yl)sulfamoyl]carbamate (PubChem CID 114464571) has the molecular formula C9H16N4O4S and a molecular weight of 276.32 g/mol. Its IUPAC name is methyl N-[(5-tert-butyl-1H-pyrazol-3-yl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(5-tert-butyl-1H-pyrazol-3-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464571 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl N-[(5-tert-butyl-1H-pyrazol-3-yl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C9H16N4O4S/c1-9(2,3)6-5-7(11-10-6)12-18(15,16)13-8(14)17-4/h5H,1-4H3,(H,13,14)(H2,10,11,12) |
| InChIKey | GCJFKUCPUALZHI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |