C11H22N4O2S — CID 113258114
5-tert-butyl-3-(diethylsulfamoylamino)-1H-pyrazole (PubChem CID 113258114) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-tert-butyl-3-(diethylsulfamoylamino)-1H-pyrazole.
| Compound Name | 5-tert-butyl-3-(diethylsulfamoylamino)-1H-pyrazole |
|---|---|
| PubChem CID | 113258114 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-tert-butyl-3-(diethylsulfamoylamino)-1H-pyrazole |
| SMILES | CCN(CC)S(=O)(=O)Nc1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C11H22N4O2S/c1-6-15(7-2)18(16,17)14-10-8-9(12-13-10)11(3,4)5/h8H,6-7H2,1-5H3,(H2,12,13,14) |
| InChIKey | OHQHMKDBHUXWKI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |