C11H18N6O2S — CID 104616984
3-amino-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-methylpyrazole-4-sulfonamide (PubChem CID 104616984) has the molecular formula C11H18N6O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-amino-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 104616984 |
| Molecular Formula | C11H18N6O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-amino-N-(5-tert-butyl-1H-pyrazol-3-yl)-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2cc(C(C)(C)C)[nH]n2)c(N)n1 |
| InChI | InChI=1S/C11H18N6O2S/c1-11(2,3)8-5-9(14-13-8)16-20(18,19)7-6-17(4)15-10(7)12/h5-6H,1-4H3,(H2,12,15)(H2,13,14,16) |
| InChIKey | WCPZNQKGYZCSKP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |