C13H17BrN4O2S — CID 104616990
5-amino-2-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)benzenesulfonamide (PubChem CID 104616990) has the molecular formula C13H17BrN4O2S and a molecular weight of 373.28 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104616990 |
| Molecular Formula | C13H17BrN4O2S |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 5-amino-2-bromo-N-(5-tert-butyl-1H-pyrazol-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)c1cc(NS(=O)(=O)c2cc(N)ccc2Br)n[nH]1 |
| InChI | InChI=1S/C13H17BrN4O2S/c1-13(2,3)11-7-12(17-16-11)18-21(19,20)10-6-8(15)4-5-9(10)14/h4-7H,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | SWBSCLZIKSEITG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|