C8H12BrN3O2S — CID 83013292
5-amino-2-bromo-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 83013292) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 5-amino-2-bromo-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 5-amino-2-bromo-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83013292 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-amino-2-bromo-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C8H12BrN3O2S/c1-12(2)11-15(13,14)8-5-6(10)3-4-7(8)9/h3-5,11H,10H2,1-2H3 |
| InChIKey | YXPIOCKYZSHQGQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|