C13H21BrN2O2S — CID 65206847
5-amino-2-bromo-N-(3-ethylpentan-3-yl)benzenesulfonamide (PubChem CID 65206847) has the molecular formula C13H21BrN2O2S and a molecular weight of 349.29 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(3-ethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(3-ethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 65206847 |
| Molecular Formula | C13H21BrN2O2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-amino-2-bromo-N-(3-ethylpentan-3-yl)benzenesulfonamide |
| SMILES | CCC(CC)(CC)NS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C13H21BrN2O2S/c1-4-13(5-2,6-3)16-19(17,18)12-9-10(15)7-8-11(12)14/h7-9,16H,4-6,15H2,1-3H3 |
| InChIKey | RLACPVVBSAYRMS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|