C9H13BrN2O2S — CID 65202371
5-amino-2-bromo-N-propylbenzenesulfonamide (PubChem CID 65202371) has the molecular formula C9H13BrN2O2S and a molecular weight of 293.19 g/mol. Its IUPAC name is 5-amino-2-bromo-N-propylbenzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 65202371 |
| Molecular Formula | C9H13BrN2O2S |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 5-amino-2-bromo-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C9H13BrN2O2S/c1-2-5-12-15(13,14)9-6-7(11)3-4-8(9)10/h3-4,6,12H,2,5,11H2,1H3 |
| InChIKey | LQLBGRODDHRSLB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|