C10H15BrN2O3S — CID 106840167
5-amino-2-bromo-N-(4-hydroxybutyl)benzenesulfonamide (PubChem CID 106840167) has the molecular formula C10H15BrN2O3S and a molecular weight of 323.21 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(4-hydroxybutyl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(4-hydroxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106840167 |
| Molecular Formula | C10H15BrN2O3S |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 5-amino-2-bromo-N-(4-hydroxybutyl)benzenesulfonamide |
| SMILES | Nc1ccc(Br)c(S(=O)(=O)NCCCCO)c1 |
| InChI | InChI=1S/C10H15BrN2O3S/c11-9-4-3-8(12)7-10(9)17(15,16)13-5-1-2-6-14/h3-4,7,13-14H,1-2,5-6,12H2 |
| InChIKey | GQUMGSYUTUMGLM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|