C10H16BrN3O4S2 — CID 106333529
5-amino-2-bromo-N-[2-(ethylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 106333529) has the molecular formula C10H16BrN3O4S2 and a molecular weight of 386.29 g/mol. Its IUPAC name is 5-amino-2-bromo-N-[2-(ethylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-[2-(ethylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333529 |
| Molecular Formula | C10H16BrN3O4S2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 5-amino-2-bromo-N-[2-(ethylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C10H16BrN3O4S2/c1-2-13-19(15,16)6-5-14-20(17,18)10-7-8(12)3-4-9(10)11/h3-4,7,13-14H,2,5-6,12H2,1H3 |
| InChIKey | NURYXVZZFJMUFL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|