C9H14FN3O4S2 — CID 106333323
5-amino-2-fluoro-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 106333323) has the molecular formula C9H14FN3O4S2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333323 |
| Molecular Formula | C9H14FN3O4S2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-amino-2-fluoro-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C9H14FN3O4S2/c1-12-18(14,15)5-4-13-19(16,17)9-6-7(11)2-3-8(9)10/h2-3,6,12-13H,4-5,11H2,1H3 |
| InChIKey | CUEMKQMVDFPMTE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|