C10H14FNO6S3 — CID 60918249
2-fluoro-5-methylsulfonyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 60918249) has the molecular formula C10H14FNO6S3 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-fluoro-5-methylsulfonyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-methylsulfonyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60918249 |
| Molecular Formula | C10H14FNO6S3 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 2-fluoro-5-methylsulfonyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C10H14FNO6S3/c1-19(13,14)6-5-12-21(17,18)10-7-8(20(2,15)16)3-4-9(10)11/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | NPGQAVPDNFBQQL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |