C10H14FNO5S2 — CID 83058758
2-fluoro-N-[(2R)-2-hydroxypropyl]-5-methylsulfonylbenzenesulfonamide (PubChem CID 83058758) has the molecular formula C10H14FNO5S2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-2-hydroxypropyl]-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[(2R)-2-hydroxypropyl]-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 83058758 |
| Molecular Formula | C10H14FNO5S2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-fluoro-N-[(2R)-2-hydroxypropyl]-5-methylsulfonylbenzenesulfonamide |
| SMILES | C[C@@H](O)CNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C10H14FNO5S2/c1-7(13)6-12-19(16,17)10-5-8(18(2,14)15)3-4-9(10)11/h3-5,7,12-13H,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | AWUUDJGBOROYRH-SSDOTTSWSA-N |
| XLogP | -0.11 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |