C12H16FNO4S2 — CID 113465537
2-fluoro-5-methylsulfonyl-N-[(E)-pent-3-enyl]benzenesulfonamide (PubChem CID 113465537) has the molecular formula C12H16FNO4S2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-fluoro-5-methylsulfonyl-N-[(E)-pent-3-enyl]benzenesulfonamide.
| Compound Name | 2-fluoro-5-methylsulfonyl-N-[(E)-pent-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113465537 |
| Molecular Formula | C12H16FNO4S2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-fluoro-5-methylsulfonyl-N-[(E)-pent-3-enyl]benzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H16FNO4S2/c1-3-4-5-8-14-20(17,18)12-9-10(19(2,15)16)6-7-11(12)13/h3-4,6-7,9,14H,5,8H2,1-2H3/b4-3+ |
| InChIKey | UDWMRAQSPONHOR-ONEGZZNKSA-N |
| XLogP | 1.47 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|