C11H16FNO5S2 — CID 43591361
N-(2-ethoxyethyl)-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 43591361) has the molecular formula C11H16FNO5S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-ethoxyethyl)-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 43591361 |
| Molecular Formula | C11H16FNO5S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-(2-ethoxyethyl)-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H16FNO5S2/c1-3-18-7-6-13-20(16,17)11-8-9(19(2,14)15)4-5-10(11)12/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | IVVLSYKTDBBCNH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|