C12H14FNO4S3 — CID 106427308
2-fluoro-5-methylsulfonyl-N-(2-prop-2-ynylsulfanylethyl)benzenesulfonamide (PubChem CID 106427308) has the molecular formula C12H14FNO4S3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-fluoro-5-methylsulfonyl-N-(2-prop-2-ynylsulfanylethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-methylsulfonyl-N-(2-prop-2-ynylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106427308 |
| Molecular Formula | C12H14FNO4S3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-fluoro-5-methylsulfonyl-N-(2-prop-2-ynylsulfanylethyl)benzenesulfonamide |
| SMILES | C#CCSCCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H14FNO4S3/c1-3-7-19-8-6-14-21(17,18)12-9-10(20(2,15)16)4-5-11(12)13/h1,4-5,9,14H,6-8H2,2H3 |
| InChIKey | FZNSJEUEPFTXHL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|