C9H12FNO5S2 — CID 64973761
N-ethoxy-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 64973761) has the molecular formula C9H12FNO5S2 and a molecular weight of 297.33 g/mol. Its IUPAC name is N-ethoxy-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-ethoxy-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 64973761 |
| Molecular Formula | C9H12FNO5S2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | N-ethoxy-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C9H12FNO5S2/c1-3-16-11-18(14,15)9-6-7(17(2,12)13)4-5-8(9)10/h4-6,11H,3H2,1-2H3 |
| InChIKey | LDRWZSLSEPLIHF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|