C12H17ClFNO4S2 — CID 65032315
N-(1-chloro-2-methylbutan-2-yl)-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 65032315) has the molecular formula C12H17ClFNO4S2 and a molecular weight of 357.86 g/mol. Its IUPAC name is N-(1-chloro-2-methylbutan-2-yl)-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(1-chloro-2-methylbutan-2-yl)-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 65032315 |
| Molecular Formula | C12H17ClFNO4S2 |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-(1-chloro-2-methylbutan-2-yl)-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCC(C)(CCl)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H17ClFNO4S2/c1-4-12(2,8-13)15-21(18,19)11-7-9(20(3,16)17)5-6-10(11)14/h5-7,15H,4,8H2,1-3H3 |
| InChIKey | MICBETAODAGORW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|