C11H14ClF2NO2S — CID 65032918
N-(1-chloro-2-methylbutan-2-yl)-3,4-difluorobenzenesulfonamide (PubChem CID 65032918) has the molecular formula C11H14ClF2NO2S and a molecular weight of 297.75 g/mol. Its IUPAC name is N-(1-chloro-2-methylbutan-2-yl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(1-chloro-2-methylbutan-2-yl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65032918 |
| Molecular Formula | C11H14ClF2NO2S |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(1-chloro-2-methylbutan-2-yl)-3,4-difluorobenzenesulfonamide |
| SMILES | CCC(C)(CCl)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14ClF2NO2S/c1-3-11(2,7-12)15-18(16,17)8-4-5-9(13)10(14)6-8/h4-6,15H,3,7H2,1-2H3 |
| InChIKey | PHMOSPCASJMLAS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|