C12H17Cl2NO3S — CID 106169954
3,4-dichloro-N-(1-hydroxy-3-methylpentan-3-yl)benzenesulfonamide (PubChem CID 106169954) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-hydroxy-3-methylpentan-3-yl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(1-hydroxy-3-methylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106169954 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3,4-dichloro-N-(1-hydroxy-3-methylpentan-3-yl)benzenesulfonamide |
| SMILES | CCC(C)(CCO)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO3S/c1-3-12(2,6-7-16)15-19(17,18)9-4-5-10(13)11(14)8-9/h4-5,8,15-16H,3,6-7H2,1-2H3 |
| InChIKey | LKKQXWNZGOLCJW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |