C10H16ClNO3S2 — CID 114153362
5-chloro-N-(1-hydroxy-3-methylpentan-3-yl)thiophene-2-sulfonamide (PubChem CID 114153362) has the molecular formula C10H16ClNO3S2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxy-3-methylpentan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(1-hydroxy-3-methylpentan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114153362 |
| Molecular Formula | C10H16ClNO3S2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-chloro-N-(1-hydroxy-3-methylpentan-3-yl)thiophene-2-sulfonamide |
| SMILES | CCC(C)(CCO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H16ClNO3S2/c1-3-10(2,6-7-13)12-17(14,15)9-5-4-8(11)16-9/h4-5,12-13H,3,6-7H2,1-2H3 |
| InChIKey | UKKLAHSNGPGXEW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |