C9H13Br2NO2S2 — CID 114293803
5-bromo-N-(1-bromo-2-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 114293803) has the molecular formula C9H13Br2NO2S2 and a molecular weight of 391.15 g/mol. Its IUPAC name is 5-bromo-N-(1-bromo-2-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-bromo-2-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114293803 |
| Molecular Formula | C9H13Br2NO2S2 |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 5-bromo-N-(1-bromo-2-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCC(C)(CBr)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H13Br2NO2S2/c1-3-9(2,6-10)12-16(13,14)8-5-4-7(11)15-8/h4-5,12H,3,6H2,1-2H3 |
| InChIKey | SXIWUUPBXMYBJO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|