C8H11BrN2O3S2 — CID 61392292
2-[(5-bromothiophen-2-yl)sulfonylamino]-2-methylpropanamide (PubChem CID 61392292) has the molecular formula C8H11BrN2O3S2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 61392292 |
| Molecular Formula | C8H11BrN2O3S2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(Br)s1)C(N)=O |
| InChI | InChI=1S/C8H11BrN2O3S2/c1-8(2,7(10)12)11-16(13,14)6-4-3-5(9)15-6/h3-4,11H,1-2H3,(H2,10,12) |
| InChIKey | ATGPTKUXINSVJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |