C5H6BrN3O2S3 — CID 65214417
[(5-bromothiophen-2-yl)sulfonylamino]thiourea (PubChem CID 65214417) has the molecular formula C5H6BrN3O2S3 and a molecular weight of 316.23 g/mol. Its IUPAC name is [(5-bromothiophen-2-yl)sulfonylamino]thiourea.
| Compound Name | [(5-bromothiophen-2-yl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 65214417 |
| Molecular Formula | C5H6BrN3O2S3 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 314.88 |
| IUPAC Name | [(5-bromothiophen-2-yl)sulfonylamino]thiourea |
| SMILES | NC(=S)NNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C5H6BrN3O2S3/c6-3-1-2-4(13-3)14(10,11)9-8-5(7)12/h1-2,9H,(H3,7,8,12) |
| InChIKey | ZNYTWJXOLPDAPT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|