C12H11BrN2O3S3 — CID 43369773
2-[2-[(5-bromothiophen-2-yl)sulfonylamino]phenoxy]ethanethioamide (PubChem CID 43369773) has the molecular formula C12H11BrN2O3S3 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-[2-[(5-bromothiophen-2-yl)sulfonylamino]phenoxy]ethanethioamide.
| Compound Name | 2-[2-[(5-bromothiophen-2-yl)sulfonylamino]phenoxy]ethanethioamide |
|---|---|
| PubChem CID | 43369773 |
| Molecular Formula | C12H11BrN2O3S3 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 2-[2-[(5-bromothiophen-2-yl)sulfonylamino]phenoxy]ethanethioamide |
| SMILES | NC(=S)COc1ccccc1NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H11BrN2O3S3/c13-10-5-6-12(20-10)21(16,17)15-8-3-1-2-4-9(8)18-7-11(14)19/h1-6,15H,7H2,(H2,14,19) |
| InChIKey | GSRDZQCRRCKRSA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|