C14H16BrNO4S2 — CID 3868034
5-bromo-N-(2,5-diethoxyphenyl)thiophene-2-sulfonamide (PubChem CID 3868034) has the molecular formula C14H16BrNO4S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 5-bromo-N-(2,5-diethoxyphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2,5-diethoxyphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3868034 |
| Molecular Formula | C14H16BrNO4S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 5-bromo-N-(2,5-diethoxyphenyl)thiophene-2-sulfonamide |
| SMILES | CCOc1ccc(OCC)c(NS(=O)(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H16BrNO4S2/c1-3-19-10-5-6-12(20-4-2)11(9-10)16-22(17,18)14-8-7-13(15)21-14/h5-9,16H,3-4H2,1-2H3 |
| InChIKey | OBFPVBDGMGUTHL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |