C10H6Br3NO2S2 — CID 22773592
5-bromo-N-(2,4-dibromophenyl)thiophene-2-sulfonamide (PubChem CID 22773592) has the molecular formula C10H6Br3NO2S2 and a molecular weight of 476.01 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dibromophenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2,4-dibromophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22773592 |
| Molecular Formula | C10H6Br3NO2S2 |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 472.74 |
| IUPAC Name | 5-bromo-N-(2,4-dibromophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)cc1Br)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H6Br3NO2S2/c11-6-1-2-8(7(12)5-6)14-18(15,16)10-4-3-9(13)17-10/h1-5,14H |
| InChIKey | AKOAETPFCFADJU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |