C10H6Br2ClNO2S2 — CID 4845679
5-chloro-N-(2,4-dibromophenyl)thiophene-2-sulfonamide (PubChem CID 4845679) has the molecular formula C10H6Br2ClNO2S2 and a molecular weight of 431.56 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dibromophenyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,4-dibromophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4845679 |
| Molecular Formula | C10H6Br2ClNO2S2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 428.79 |
| IUPAC Name | 5-chloro-N-(2,4-dibromophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)cc1Br)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H6Br2ClNO2S2/c11-6-1-2-8(7(12)5-6)14-18(15,16)10-4-3-9(13)17-10/h1-5,14H |
| InChIKey | VQVVWMPPLRZMAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |