C11H6BrClN2O2S3 — CID 16934156
N-(6-bromo-1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide (PubChem CID 16934156) has the molecular formula C11H6BrClN2O2S3 and a molecular weight of 409.74 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16934156 |
| Molecular Formula | C11H6BrClN2O2S3 |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 407.85 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccc(Br)cc2s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H6BrClN2O2S3/c12-6-1-2-7-8(5-6)18-11(14-7)15-20(16,17)10-4-3-9(13)19-10/h1-5H,(H,14,15) |
| InChIKey | SGQXPGXTHLGGAP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |