C11H6ClFN2O2S3 — CID 167944643
5-chloro-N-(5-fluoro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 167944643) has the molecular formula C11H6ClFN2O2S3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 5-chloro-N-(5-fluoro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5-fluoro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 167944643 |
| Molecular Formula | C11H6ClFN2O2S3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 5-chloro-N-(5-fluoro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2cc(F)ccc2s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H6ClFN2O2S3/c12-9-3-4-10(19-9)20(16,17)15-11-14-7-5-6(13)1-2-8(7)18-11/h1-5H,(H,14,15) |
| InChIKey | JEHWQVKOFYHDNB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |