C13H8BrClN2O2S2 — CID 129127454
N-(5-bromo-1,3-benzothiazol-2-yl)-4-chlorobenzenesulfonamide (PubChem CID 129127454) has the molecular formula C13H8BrClN2O2S2 and a molecular weight of 403.71 g/mol. Its IUPAC name is N-(5-bromo-1,3-benzothiazol-2-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(5-bromo-1,3-benzothiazol-2-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 129127454 |
| Molecular Formula | C13H8BrClN2O2S2 |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | N-(5-bromo-1,3-benzothiazol-2-yl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2cc(Br)ccc2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H8BrClN2O2S2/c14-8-1-6-12-11(7-8)16-13(20-12)17-21(18,19)10-4-2-9(15)3-5-10/h1-7H,(H,16,17) |
| InChIKey | GKXHQVHWIABSHZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |