C15H10BrClN2O2S2 — CID 91966356
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-chlorobenzenesulfonamide (PubChem CID 91966356) has the molecular formula C15H10BrClN2O2S2 and a molecular weight of 429.75 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 91966356 |
| Molecular Formula | C15H10BrClN2O2S2 |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 427.91 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccc(Br)cc2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10BrClN2O2S2/c16-11-3-1-10(2-4-11)14-9-22-15(18-14)19-23(20,21)13-7-5-12(17)6-8-13/h1-9H,(H,18,19) |
| InChIKey | CCJPVLRIVOTOBT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|