C18H13ClF3N3O3S2 — CID 112769091
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 112769091) has the molecular formula C18H13ClF3N3O3S2 and a molecular weight of 475.90 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 112769091 |
| Molecular Formula | C18H13ClF3N3O3S2 |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H13ClF3N3O3S2/c19-13-5-1-11(2-6-13)15-9-29-17(24-15)25-30(27,28)14-7-3-12(4-8-14)16(26)23-10-18(20,21)22/h1-9H,10H2,(H,23,26)(H,24,25) |
| InChIKey | ZOZKRUNBWUZOOC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|