C11H10F3N3O2S2 — CID 51107739
4-[2-(2,2,2-trifluoroethylamino)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 51107739) has the molecular formula C11H10F3N3O2S2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-[2-(2,2,2-trifluoroethylamino)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-(2,2,2-trifluoroethylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 51107739 |
| Molecular Formula | C11H10F3N3O2S2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4-[2-(2,2,2-trifluoroethylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2csc(NCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C11H10F3N3O2S2/c12-11(13,14)6-16-10-17-9(5-20-10)7-1-3-8(4-2-7)21(15,18)19/h1-5H,6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | BVRMOAQNVRHUET-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |