C15H13N3O4S2 — CID 2928782
4-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide (PubChem CID 2928782) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 2928782 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 4-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(-c3ccc(O)c(O)c3)cs2)cc1 |
| InChI | InChI=1S/C15H13N3O4S2/c16-24(21,22)11-4-2-10(3-5-11)17-15-18-12(8-23-15)9-1-6-13(19)14(20)7-9/h1-8,19-20H,(H,17,18)(H2,16,21,22) |
| InChIKey | OTCVEBGHBZITPZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|