C17H16N2O2S — CID 2177996
4-[2-(2-ethylanilino)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 2177996) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-[2-(2-ethylanilino)-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(2-ethylanilino)-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 2177996 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-[2-(2-ethylanilino)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | CCc1ccccc1Nc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C17H16N2O2S/c1-2-11-5-3-4-6-13(11)18-17-19-14(10-22-17)12-7-8-15(20)16(21)9-12/h3-10,20-21H,2H2,1H3,(H,18,19) |
| InChIKey | ROKURQQRRXXCGI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|