C23H18N2O3S — CID 11516941
5-[2-(4-benzylanilino)-1,3-thiazol-4-yl]-2-hydroxybenzoic acid (PubChem CID 11516941) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-[2-(4-benzylanilino)-1,3-thiazol-4-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(4-benzylanilino)-1,3-thiazol-4-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 11516941 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 5-[2-(4-benzylanilino)-1,3-thiazol-4-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(-c2csc(Nc3ccc(Cc4ccccc4)cc3)n2)ccc1O |
| InChI | InChI=1S/C23H18N2O3S/c26-21-11-8-17(13-19(21)22(27)28)20-14-29-23(25-20)24-18-9-6-16(7-10-18)12-15-4-2-1-3-5-15/h1-11,13-14,26H,12H2,(H,24,25)(H,27,28) |
| InChIKey | BJNPPGLYYHTNCO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |