C22H16Cl2N2S — CID 58791991
N-(3-benzylphenyl)-4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 58791991) has the molecular formula C22H16Cl2N2S and a molecular weight of 411.36 g/mol. Its IUPAC name is N-(3-benzylphenyl)-4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-benzylphenyl)-4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791991 |
| Molecular Formula | C22H16Cl2N2S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-(3-benzylphenyl)-4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(Nc3cccc(Cc4ccccc4)c3)n2)cc1Cl |
| InChI | InChI=1S/C22H16Cl2N2S/c23-19-10-9-17(13-20(19)24)21-14-27-22(26-21)25-18-8-4-7-16(12-18)11-15-5-2-1-3-6-15/h1-10,12-14H,11H2,(H,25,26) |
| InChIKey | KKHINJRSLGOLBZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |