C15H9Cl2FN2S — CID 166194872
4-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 166194872) has the molecular formula C15H9Cl2FN2S and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 166194872 |
| Molecular Formula | C15H9Cl2FN2S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C15H9Cl2FN2S/c16-12-6-1-9(7-13(12)17)14-8-21-15(20-14)19-11-4-2-10(18)3-5-11/h1-8H,(H,19,20) |
| InChIKey | IVMXHVILVZUHQT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |