C16H13FN2OS — CID 4093037
4-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 4093037) has the molecular formula C16H13FN2OS and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4093037 |
| Molecular Formula | C16H13FN2OS |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C16H13FN2OS/c1-20-14-8-6-13(7-9-14)18-16-19-15(10-21-16)11-2-4-12(17)5-3-11/h2-10H,1H3,(H,18,19) |
| InChIKey | ZJZCGGNUYGEJAZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |