C18H17FN2OS — CID 12790440
4-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 12790440) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 12790440 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CCNc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H17FN2OS/c1-22-16-8-2-13(3-9-16)10-11-20-18-21-17(12-23-18)14-4-6-15(19)7-5-14/h2-9,12H,10-11H2,1H3,(H,20,21) |
| InChIKey | WZBBWWWJHUVYIC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |