C10H11N3OS — CID 5211248
[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 5211248) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 5211248 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [4-(4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | COc1ccc(-c2csc(NN)n2)cc1 |
| InChI | InChI=1S/C10H11N3OS/c1-14-8-4-2-7(3-5-8)9-6-15-10(12-9)13-11/h2-6H,11H2,1H3,(H,12,13) |
| InChIKey | QBSBVOHLMZHINL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|