C12H10F3N3O2S — CID 1497723
2,2,2-trifluoro-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetohydrazide (PubChem CID 1497723) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 1497723 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2,2,2-trifluoro-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetohydrazide |
| SMILES | COc1ccc(-c2csc(NNC(=O)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H10F3N3O2S/c1-20-8-4-2-7(3-5-8)9-6-21-11(16-9)18-17-10(19)12(13,14)15/h2-6H,1H3,(H,16,18)(H,17,19) |
| InChIKey | NXUDBGCIEZJVRW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|