C11H7BrF3N3OS — CID 1497824
N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetohydrazide (PubChem CID 1497824) has the molecular formula C11H7BrF3N3OS and a molecular weight of 366.16 g/mol. Its IUPAC name is N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetohydrazide.
| Compound Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetohydrazide |
|---|---|
| PubChem CID | 1497824 |
| Molecular Formula | C11H7BrF3N3OS |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetohydrazide |
| SMILES | O=C(NNc1nc(-c2ccc(Br)cc2)cs1)C(F)(F)F |
| InChI | InChI=1S/C11H7BrF3N3OS/c12-7-3-1-6(2-4-7)8-5-20-10(16-8)18-17-9(19)11(13,14)15/h1-5H,(H,16,18)(H,17,19) |
| InChIKey | JNPXZSKGRMAXSI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|