C16H12BrN3OS — CID 28861346
N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-bromobenzamide (PubChem CID 28861346) has the molecular formula C16H12BrN3OS and a molecular weight of 374.26 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-bromobenzamide.
| Compound Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-bromobenzamide |
|---|---|
| PubChem CID | 28861346 |
| Molecular Formula | C16H12BrN3OS |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-bromobenzamide |
| SMILES | Nc1ccc(-c2csc(NC(=O)c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C16H12BrN3OS/c17-12-5-1-11(2-6-12)15(21)20-16-19-14(9-22-16)10-3-7-13(18)8-4-10/h1-9H,18H2,(H,19,20,21) |
| InChIKey | FRLHIPKQZGODMK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|