C18H16BrN3OS — CID 3584332
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide (PubChem CID 3584332) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 3584332 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2nc(-c3ccc(Br)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H16BrN3OS/c1-22(2)15-9-5-13(6-10-15)17(23)21-18-20-16(11-24-18)12-3-7-14(19)8-4-12/h3-11H,1-2H3,(H,20,21,23) |
| InChIKey | FHMXTZARZZAHMO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |