C14H10BrN3O2S — CID 28861401
N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-5-bromofuran-2-carboxamide (PubChem CID 28861401) has the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 28861401 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-5-bromofuran-2-carboxamide |
| SMILES | Nc1ccc(-c2csc(NC(=O)c3ccc(Br)o3)n2)cc1 |
| InChI | InChI=1S/C14H10BrN3O2S/c15-12-6-5-11(20-12)13(19)18-14-17-10(7-21-14)8-1-3-9(16)4-2-8/h1-7H,16H2,(H,17,18,19) |
| InChIKey | FSFRRBMNPDKGGO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|