C24H16N2O3S — CID 8718079
N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 8718079) has the molecular formula C24H16N2O3S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8718079 |
| Molecular Formula | C24H16N2O3S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H16N2O3S/c27-23(22-14-17-6-4-5-9-21(17)29-22)26-24-25-20(15-30-24)16-10-12-19(13-11-16)28-18-7-2-1-3-8-18/h1-15H,(H,25,26,27) |
| InChIKey | DXQSZIJEMBEFHB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |