C22H17N3O2S — CID 1044223
1-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 1044223) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 1044223 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C22H17N3O2S/c26-21(23-17-7-3-1-4-8-17)25-22-24-20(15-28-22)16-11-13-19(14-12-16)27-18-9-5-2-6-10-18/h1-15H,(H2,23,24,25,26) |
| InChIKey | WSGXJSQUDUWVJE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |