C35H25N3O4S — CID 4138513
2-phenoxy-N-[4-[2-[(2-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 4138513) has the molecular formula C35H25N3O4S and a molecular weight of 583.67 g/mol. Its IUPAC name is 2-phenoxy-N-[4-[2-[(2-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 2-phenoxy-N-[4-[2-[(2-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4138513 |
| Molecular Formula | C35H25N3O4S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 2-phenoxy-N-[4-[2-[(2-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2csc(NC(=O)c3ccccc3Oc3ccccc3)n2)cc1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C35H25N3O4S/c39-33(28-15-7-9-17-31(28)41-26-11-3-1-4-12-26)36-25-21-19-24(20-22-25)30-23-43-35(37-30)38-34(40)29-16-8-10-18-32(29)42-27-13-5-2-6-14-27/h1-23H,(H,36,39)(H,37,38,40) |
| InChIKey | OOQNLXPYSXGBMX-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |