C22H17N3OS — CID 4274968
1-phenyl-3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]urea (PubChem CID 4274968) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-phenyl-3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-phenyl-3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 4274968 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-phenyl-3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1ccccc1)Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C22H17N3OS/c26-21(23-19-9-5-2-6-10-19)25-22-24-20(15-27-22)18-13-11-17(12-14-18)16-7-3-1-4-8-16/h1-15H,(H2,23,24,25,26) |
| InChIKey | BIBHWXIBPULHRV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |